C16H24N2O2 — CID 32688592
2,2-dimethyl-N-[4-(2-methylanilino)-4-oxobutyl]propanamide (PubChem CID 32688592) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-(2-methylanilino)-4-oxobutyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-(2-methylanilino)-4-oxobutyl]propanamide |
|---|---|
| PubChem CID | 32688592 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2,2-dimethyl-N-[4-(2-methylanilino)-4-oxobutyl]propanamide |
| SMILES | Cc1ccccc1NC(=O)CCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H24N2O2/c1-12-8-5-6-9-13(12)18-14(19)10-7-11-17-15(20)16(2,3)4/h5-6,8-9H,7,10-11H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | LDEDLTDCZSQDNL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|