C24H32N2O2 — CID 32576772
N-[4-[[(R)-(3,4-dimethylphenyl)-phenylmethyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 32576772) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-[4-[[(R)-(3,4-dimethylphenyl)-phenylmethyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[[(R)-(3,4-dimethylphenyl)-phenylmethyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 32576772 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N-[4-[[(R)-(3,4-dimethylphenyl)-phenylmethyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc([C@H](NC(=O)CCCNC(=O)C(C)(C)C)c2ccccc2)cc1C |
| InChI | InChI=1S/C24H32N2O2/c1-17-13-14-20(16-18(17)2)22(19-10-7-6-8-11-19)26-21(27)12-9-15-25-23(28)24(3,4)5/h6-8,10-11,13-14,16,22H,9,12,15H2,1-5H3,(H,25,28)(H,26,27)/t22-/m1/s1 |
| InChIKey | JFEHRLJLKJOCFX-JOCHJYFZSA-N |
| XLogP | 4.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|