C24H34N2O2S — CID 75867748
N-[4-[[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 75867748) has the molecular formula C24H34N2O2S and a molecular weight of 414.62 g/mol. Its IUPAC name is N-[4-[[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 75867748 |
| Molecular Formula | C24H34N2O2S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-[4-[[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]amino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CCC(C)c1ccc(C(NC(=O)CCCNC(=O)C(C)(C)C)c2cccs2)cc1 |
| InChI | InChI=1S/C24H34N2O2S/c1-6-17(2)18-11-13-19(14-12-18)22(20-9-8-16-29-20)26-21(27)10-7-15-25-23(28)24(3,4)5/h8-9,11-14,16-17,22H,6-7,10,15H2,1-5H3,(H,25,28)(H,26,27) |
| InChIKey | UQZDBNQTQXEQRT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|