C23H25NO3S2 — CID 46616393
N-[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]-4-methylsulfonylbenzamide (PubChem CID 46616393) has the molecular formula C23H25NO3S2 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 46616393 |
| Molecular Formula | C23H25NO3S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[(4-butan-2-ylphenyl)-thiophen-2-ylmethyl]-4-methylsulfonylbenzamide |
| SMILES | CCC(C)c1ccc(C(NC(=O)c2ccc(S(C)(=O)=O)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C23H25NO3S2/c1-4-16(2)17-7-9-18(10-8-17)22(21-6-5-15-28-21)24-23(25)19-11-13-20(14-12-19)29(3,26)27/h5-16,22H,4H2,1-3H3,(H,24,25) |
| InChIKey | JXNBLSATEXPBJA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |