C23H26N2O4S2 — CID 55825217
4-(methoxysulfamoyl)-N-[[4-(2-methylpropyl)phenyl]-thiophen-2-ylmethyl]benzamide (PubChem CID 55825217) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 4-(methoxysulfamoyl)-N-[[4-(2-methylpropyl)phenyl]-thiophen-2-ylmethyl]benzamide.
| Compound Name | 4-(methoxysulfamoyl)-N-[[4-(2-methylpropyl)phenyl]-thiophen-2-ylmethyl]benzamide |
|---|---|
| PubChem CID | 55825217 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 4-(methoxysulfamoyl)-N-[[4-(2-methylpropyl)phenyl]-thiophen-2-ylmethyl]benzamide |
| SMILES | CONS(=O)(=O)c1ccc(C(=O)NC(c2ccc(CC(C)C)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C23H26N2O4S2/c1-16(2)15-17-6-8-18(9-7-17)22(21-5-4-14-30-21)24-23(26)19-10-12-20(13-11-19)31(27,28)25-29-3/h4-14,16,22,25H,15H2,1-3H3,(H,24,26) |
| InChIKey | IDYSOTBRLYLNKK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|