C19H15ClN2O2S — CID 71888540
4-N-[(4-chlorophenyl)-thiophen-2-ylmethyl]benzene-1,4-dicarboxamide (PubChem CID 71888540) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is 4-N-[(4-chlorophenyl)-thiophen-2-ylmethyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(4-chlorophenyl)-thiophen-2-ylmethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 71888540 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-N-[(4-chlorophenyl)-thiophen-2-ylmethyl]benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NC(c2ccc(Cl)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C19H15ClN2O2S/c20-15-9-7-12(8-10-15)17(16-2-1-11-25-16)22-19(24)14-5-3-13(4-6-14)18(21)23/h1-11,17H,(H2,21,23)(H,22,24) |
| InChIKey | MSDQBJUXAHZPAF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |