C17H12Cl2N2OS — CID 99812951
3-chloro-N-[(S)-(4-chlorophenyl)-thiophen-2-ylmethyl]pyridine-4-carboxamide (PubChem CID 99812951) has the molecular formula C17H12Cl2N2OS and a molecular weight of 363.27 g/mol. Its IUPAC name is 3-chloro-N-[(S)-(4-chlorophenyl)-thiophen-2-ylmethyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[(S)-(4-chlorophenyl)-thiophen-2-ylmethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 99812951 |
| Molecular Formula | C17H12Cl2N2OS |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 3-chloro-N-[(S)-(4-chlorophenyl)-thiophen-2-ylmethyl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@@H](c1ccc(Cl)cc1)c1cccs1)c1ccncc1Cl |
| InChI | InChI=1S/C17H12Cl2N2OS/c18-12-5-3-11(4-6-12)16(15-2-1-9-23-15)21-17(22)13-7-8-20-10-14(13)19/h1-10,16H,(H,21,22)/t16-/m0/s1 |
| InChIKey | BRPDFZHPGSRBGR-INIZCTEOSA-N |
| XLogP | 4.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |