C17H14ClN3OS — CID 94129459
1-[(R)-(4-chlorophenyl)-thiophen-2-ylmethyl]-3-pyridin-2-ylurea (PubChem CID 94129459) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is 1-[(R)-(4-chlorophenyl)-thiophen-2-ylmethyl]-3-pyridin-2-ylurea.
| Compound Name | 1-[(R)-(4-chlorophenyl)-thiophen-2-ylmethyl]-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 94129459 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-[(R)-(4-chlorophenyl)-thiophen-2-ylmethyl]-3-pyridin-2-ylurea |
| SMILES | O=C(Nc1ccccn1)N[C@H](c1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C17H14ClN3OS/c18-13-8-6-12(7-9-13)16(14-4-3-11-23-14)21-17(22)20-15-5-1-2-10-19-15/h1-11,16H,(H2,19,20,21,22)/t16-/m1/s1 |
| InChIKey | CAGRJAAKITVHQL-MRXNPFEDSA-N |
| XLogP | 4.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |