C19H18ClN3OS — CID 86999645
1-[(4-chlorophenyl)-thiophen-2-ylmethyl]-3-(1-pyridin-4-ylethyl)urea (PubChem CID 86999645) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-thiophen-2-ylmethyl]-3-(1-pyridin-4-ylethyl)urea.
| Compound Name | 1-[(4-chlorophenyl)-thiophen-2-ylmethyl]-3-(1-pyridin-4-ylethyl)urea |
|---|---|
| PubChem CID | 86999645 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-[(4-chlorophenyl)-thiophen-2-ylmethyl]-3-(1-pyridin-4-ylethyl)urea |
| SMILES | CC(NC(=O)NC(c1ccc(Cl)cc1)c1cccs1)c1ccncc1 |
| InChI | InChI=1S/C19H18ClN3OS/c1-13(14-8-10-21-11-9-14)22-19(24)23-18(17-3-2-12-25-17)15-4-6-16(20)7-5-15/h2-13,18H,1H3,(H2,22,23,24) |
| InChIKey | WCKWNPMSUIBQCO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |