C12H12ClN3OS — CID 51932156
1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 51932156) has the molecular formula C12H12ClN3OS and a molecular weight of 281.77 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 51932156 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | C[C@H](NC(=O)Nc1nccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClN3OS/c1-8(9-2-4-10(13)5-3-9)15-11(17)16-12-14-6-7-18-12/h2-8H,1H3,(H2,14,15,16,17)/t8-/m0/s1 |
| InChIKey | WXMMQYZJTGEUSZ-QMMMGPOBSA-N |
| XLogP | 3.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |