C7H12N4OS — CID 82506108
1-(1-aminopropan-2-yl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 82506108) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 1-(1-aminopropan-2-yl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1-aminopropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 82506108 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-(1-aminopropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | CC(CN)NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H12N4OS/c1-5(4-8)10-6(12)11-7-9-2-3-13-7/h2-3,5H,4,8H2,1H3,(H2,9,10,11,12) |
| InChIKey | VRBSDARPOYWMLY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |