C7H11N3O2S — CID 47193219
1-(1-hydroxypropan-2-yl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 47193219) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 1-(1-hydroxypropan-2-yl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1-hydroxypropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 47193219 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 1-(1-hydroxypropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | CC(CO)NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H11N3O2S/c1-5(4-11)9-6(12)10-7-8-2-3-13-7/h2-3,5,11H,4H2,1H3,(H2,8,9,10,12) |
| InChIKey | OPEUQUVVIAZRNK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |