C15H19N3O3S — CID 53499388
1-[1-(4,5-dimethoxy-2-methylphenyl)ethyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 53499388) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-[1-(4,5-dimethoxy-2-methylphenyl)ethyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[1-(4,5-dimethoxy-2-methylphenyl)ethyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 53499388 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[1-(4,5-dimethoxy-2-methylphenyl)ethyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | COc1cc(C)c(C(C)NC(=O)Nc2nccs2)cc1OC |
| InChI | InChI=1S/C15H19N3O3S/c1-9-7-12(20-3)13(21-4)8-11(9)10(2)17-14(19)18-15-16-5-6-22-15/h5-8,10H,1-4H3,(H2,16,17,18,19) |
| InChIKey | GOEFXJBDXMWCQV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |