C12H12N2O4S — CID 141049066
2-hydroxy-4,5-dimethoxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 141049066) has the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-hydroxy-4,5-dimethoxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-hydroxy-4,5-dimethoxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 141049066 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-hydroxy-4,5-dimethoxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1cc(O)c(C(=O)Nc2nccs2)cc1OC |
| InChI | InChI=1S/C12H12N2O4S/c1-17-9-5-7(8(15)6-10(9)18-2)11(16)14-12-13-3-4-19-12/h3-6,15H,1-2H3,(H,13,14,16) |
| InChIKey | MQZDQSBBKKECAB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |