C14H16N2O3S — CID 2083346
3-methoxy-4-propoxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 2083346) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-methoxy-4-propoxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-methoxy-4-propoxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2083346 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-methoxy-4-propoxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2nccs2)cc1OC |
| InChI | InChI=1S/C14H16N2O3S/c1-3-7-19-11-5-4-10(9-12(11)18-2)13(17)16-14-15-6-8-20-14/h4-6,8-9H,3,7H2,1-2H3,(H,15,16,17) |
| InChIKey | GVMXELQLKZQBGW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |