C13H13BrN2O3S — CID 15943256
3-bromo-4-(2-methoxyethoxy)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 15943256) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is 3-bromo-4-(2-methoxyethoxy)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-bromo-4-(2-methoxyethoxy)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 15943256 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 3-bromo-4-(2-methoxyethoxy)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COCCOc1ccc(C(=O)Nc2nccs2)cc1Br |
| InChI | InChI=1S/C13H13BrN2O3S/c1-18-5-6-19-11-3-2-9(8-10(11)14)12(17)16-13-15-4-7-20-13/h2-4,7-8H,5-6H2,1H3,(H,15,16,17) |
| InChIKey | HDIGZOBBPJOHBK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|