C18H25N3O3S — CID 31038115
4-butoxy-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-methoxybenzamide (PubChem CID 31038115) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-butoxy-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-methoxybenzamide.
| Compound Name | 4-butoxy-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 31038115 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-butoxy-N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-methoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nnc(CCCC)s2)cc1OC |
| InChI | InChI=1S/C18H25N3O3S/c1-4-6-8-16-20-21-18(25-16)19-17(22)13-9-10-14(15(12-13)23-3)24-11-7-5-2/h9-10,12H,4-8,11H2,1-3H3,(H,19,21,22) |
| InChIKey | ARTNHRDRNIKOCI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|