C17H23N3O4S — CID 8933648
2,4,5-trimethoxy-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 8933648) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2,4,5-trimethoxy-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8933648 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2,4,5-trimethoxy-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCc1nnc(NC(=O)c2cc(OC)c(OC)cc2OC)s1 |
| InChI | InChI=1S/C17H23N3O4S/c1-5-6-7-8-15-19-20-17(25-15)18-16(21)11-9-13(23-3)14(24-4)10-12(11)22-2/h9-10H,5-8H2,1-4H3,(H,18,20,21) |
| InChIKey | DDSRDQYIKMHWQX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|