C14H17N3O3S — CID 811235
3,4-dimethoxy-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 811235) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 811235 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3,4-dimethoxy-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCc1nnc(NC(=O)c2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C14H17N3O3S/c1-4-5-12-16-17-14(21-12)15-13(18)9-6-7-10(19-2)11(8-9)20-3/h6-8H,4-5H2,1-3H3,(H,15,17,18) |
| InChIKey | ALHPDEPKXDQCPV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |