C19H25N3O3S — CID 55792414
N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-cyclopentyloxy-3-methoxybenzamide (PubChem CID 55792414) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-cyclopentyloxy-3-methoxybenzamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-cyclopentyloxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 55792414 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-cyclopentyloxy-3-methoxybenzamide |
| SMILES | CCCCc1nnc(NC(=O)c2ccc(OC3CCCC3)c(OC)c2)s1 |
| InChI | InChI=1S/C19H25N3O3S/c1-3-4-9-17-21-22-19(26-17)20-18(23)13-10-11-15(16(12-13)24-2)25-14-7-5-6-8-14/h10-12,14H,3-9H2,1-2H3,(H,20,22,23) |
| InChIKey | FHJFLVSRPIKVFK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |