C18H25N3O2S — CID 3099855
4-methoxy-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 3099855) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 4-methoxy-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-methoxy-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 3099855 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-methoxy-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C18H25N3O2S/c1-3-4-5-6-7-8-9-16-20-21-18(24-16)19-17(22)14-10-12-15(23-2)13-11-14/h10-13H,3-9H2,1-2H3,(H,19,21,22) |
| InChIKey | PBSPQKLRVBLEHO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|