C18H26N4O3S2 — CID 46550915
4-(methanesulfonamido)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 46550915) has the molecular formula C18H26N4O3S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 4-(methanesulfonamido)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-(methanesulfonamido)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 46550915 |
| Molecular Formula | C18H26N4O3S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-(methanesulfonamido)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2ccc(NS(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C18H26N4O3S2/c1-3-4-5-6-7-8-9-16-20-21-18(26-16)19-17(23)14-10-12-15(13-11-14)22-27(2,24)25/h10-13,22H,3-9H2,1-2H3,(H,19,21,23) |
| InChIKey | SAEARLPRCDUNBO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|