C19H27ClN4O3S2 — CID 55378023
4-chloro-3-(dimethylsulfamoyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 55378023) has the molecular formula C19H27ClN4O3S2 and a molecular weight of 459.04 g/mol. Its IUPAC name is 4-chloro-3-(dimethylsulfamoyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-chloro-3-(dimethylsulfamoyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55378023 |
| Molecular Formula | C19H27ClN4O3S2 |
| Molecular Weight | 459.04 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-chloro-3-(dimethylsulfamoyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)C)c2)s1 |
| InChI | InChI=1S/C19H27ClN4O3S2/c1-4-5-6-7-8-9-10-17-22-23-19(28-17)21-18(25)14-11-12-15(20)16(13-14)29(26,27)24(2)3/h11-13H,4-10H2,1-3H3,(H,21,23,25) |
| InChIKey | LTTWCQDIDPYQMJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.04 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|