C16H19Cl2N5O2S — CID 86987400
N-[2-[(5-butyl-1,3,4-thiadiazol-2-yl)carbamoylamino]ethyl]-3,4-dichlorobenzamide (PubChem CID 86987400) has the molecular formula C16H19Cl2N5O2S and a molecular weight of 416.33 g/mol. Its IUPAC name is N-[2-[(5-butyl-1,3,4-thiadiazol-2-yl)carbamoylamino]ethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-[(5-butyl-1,3,4-thiadiazol-2-yl)carbamoylamino]ethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 86987400 |
| Molecular Formula | C16H19Cl2N5O2S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | N-[2-[(5-butyl-1,3,4-thiadiazol-2-yl)carbamoylamino]ethyl]-3,4-dichlorobenzamide |
| SMILES | CCCCc1nnc(NC(=O)NCCNC(=O)c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C16H19Cl2N5O2S/c1-2-3-4-13-22-23-16(26-13)21-15(25)20-8-7-19-14(24)10-5-6-11(17)12(18)9-10/h5-6,9H,2-4,7-8H2,1H3,(H,19,24)(H2,20,21,23,25) |
| InChIKey | VNUKZGKTAKMRCI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|