C11H18N4O3S — CID 122074087
4-[(5-butyl-1,3,4-thiadiazol-2-yl)carbamoylamino]butanoic acid (PubChem CID 122074087) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-[(5-butyl-1,3,4-thiadiazol-2-yl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(5-butyl-1,3,4-thiadiazol-2-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122074087 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-[(5-butyl-1,3,4-thiadiazol-2-yl)carbamoylamino]butanoic acid |
| SMILES | CCCCc1nnc(NC(=O)NCCCC(=O)O)s1 |
| InChI | InChI=1S/C11H18N4O3S/c1-2-3-5-8-14-15-11(19-8)13-10(18)12-7-4-6-9(16)17/h2-7H2,1H3,(H,16,17)(H2,12,13,15,18) |
| InChIKey | OFROVGACPZEBNV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|