C10H15N3O3S — CID 82058147
3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid (PubChem CID 82058147) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid.
| Compound Name | 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 82058147 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid |
| SMILES | CCCCC(=O)Nc1nnc(CCC(=O)O)s1 |
| InChI | InChI=1S/C10H15N3O3S/c1-2-3-4-7(14)11-10-13-12-8(17-10)5-6-9(15)16/h2-6H2,1H3,(H,15,16)(H,11,13,14) |
| InChIKey | MJIBZIIIHZJGPP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |