3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid

C10H15N3O3S — CID 82058147

IUPAC3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid
SMILESCCCCC(=O)Nc1nnc(CCC(=O)O)s1
InChIInChI=1S/C10H15N3O3S/c1-2-3-4-7(14)11-10-13-12-8(17-10)5-6-9(15)16/h2-6H2,1H3,(H,15,16)(H,11,13,14)
InChIKeyMJIBZIIIHZJGPP-UHFFFAOYSA-N
MW257.31 g/mol
LogP1.68
Rot. Bonds7

About 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid

3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid (PubChem CID 82058147) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid.

Molecular Properties

Compound Name3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid
PubChem CID82058147
Molecular FormulaC10H15N3O3S
Molecular Weight257.31 g/mol
Exact Mass257.08
IUPAC Name3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid
SMILESCCCCC(=O)Nc1nnc(CCC(=O)O)s1
InChIInChI=1S/C10H15N3O3S/c1-2-3-4-7(14)11-10-13-12-8(17-10)5-6-9(15)16/h2-6H2,1H3,(H,15,16)(H,11,13,14)
InChIKeyMJIBZIIIHZJGPP-UHFFFAOYSA-N
XLogP1.68
TPSA92.18 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.31
LogP ≤ 51.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid?
The IUPAC name of 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid (CID 82058147) is 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid.
What is the SMILES notation for 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid?
The canonical SMILES for 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid is CCCCC(=O)Nc1nnc(CCC(=O)O)s1.
What is the InChIKey of 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid?
The InChIKey is MJIBZIIIHZJGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3S/c1-2-3-4-7(14)11-10-13-12-8(17-10)5-6-9(15)16/h2-6H2,1H3,(H,15,16)(H,11,13,14).
What are the key properties of 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid?
3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid has a molecular weight of 257.31 g/mol, XLogP of 1.68, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(pentanoylamino)-1,3,4-thiadiazol-2-yl]propanoic acid is sourced from PubChem (CID 82058147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).