C16H24N6O3S2 — CID 3101008
N-[5-[2-[2-[5-(butanoylamino)-1,3,4-thiadiazol-2-yl]ethoxy]ethyl]-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 3101008) has the molecular formula C16H24N6O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[5-[2-[2-[5-(butanoylamino)-1,3,4-thiadiazol-2-yl]ethoxy]ethyl]-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | N-[5-[2-[2-[5-(butanoylamino)-1,3,4-thiadiazol-2-yl]ethoxy]ethyl]-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 3101008 |
| Molecular Formula | C16H24N6O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[5-[2-[2-[5-(butanoylamino)-1,3,4-thiadiazol-2-yl]ethoxy]ethyl]-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nnc(CCOCCc2nnc(NC(=O)CCC)s2)s1 |
| InChI | InChI=1S/C16H24N6O3S2/c1-3-5-11(23)17-15-21-19-13(26-15)7-9-25-10-8-14-20-22-16(27-14)18-12(24)6-4-2/h3-10H2,1-2H3,(H,17,21,23)(H,18,22,24) |
| InChIKey | CIZCKGBGVHKRSD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|