C10H16N4O2S — CID 676814
N-ethyl-N'-(5-propyl-1,3,4-thiadiazol-2-yl)propanediamide (PubChem CID 676814) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-ethyl-N'-(5-propyl-1,3,4-thiadiazol-2-yl)propanediamide.
| Compound Name | N-ethyl-N'-(5-propyl-1,3,4-thiadiazol-2-yl)propanediamide |
|---|---|
| PubChem CID | 676814 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-ethyl-N'-(5-propyl-1,3,4-thiadiazol-2-yl)propanediamide |
| SMILES | CCCc1nnc(NC(=O)CC(=O)NCC)s1 |
| InChI | InChI=1S/C10H16N4O2S/c1-3-5-9-13-14-10(17-9)12-8(16)6-7(15)11-4-2/h3-6H2,1-2H3,(H,11,15)(H,12,14,16) |
| InChIKey | FNBRRIDTLGMLCA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|