C9H14N4OS — CID 142435171
N-(5-propyl-1,3,4-thiadiazol-2-yl)azetidine-3-carboxamide (PubChem CID 142435171) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is N-(5-propyl-1,3,4-thiadiazol-2-yl)azetidine-3-carboxamide.
| Compound Name | N-(5-propyl-1,3,4-thiadiazol-2-yl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 142435171 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(5-propyl-1,3,4-thiadiazol-2-yl)azetidine-3-carboxamide |
| SMILES | CCCc1nnc(NC(=O)C2CNC2)s1 |
| InChI | InChI=1S/C9H14N4OS/c1-2-3-7-12-13-9(15-7)11-8(14)6-4-10-5-6/h6,10H,2-5H2,1H3,(H,11,13,14) |
| InChIKey | HASXVEUGEBBFKV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |