C10H16N4OS — CID 107641885
(3R)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide (PubChem CID 107641885) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is (3R)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 107641885 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (3R)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide |
| SMILES | CCc1nnc(NC(=O)[C@@H]2CCCNC2)s1 |
| InChI | InChI=1S/C10H16N4OS/c1-2-8-13-14-10(16-8)12-9(15)7-4-3-5-11-6-7/h7,11H,2-6H2,1H3,(H,12,14,15)/t7-/m1/s1 |
| InChIKey | SOLBJRSFZAOYMH-SSDOTTSWSA-N |
| XLogP | 1.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |