C7H11N5OS — CID 104982975
(3R)-N-(thiatriazol-5-yl)piperidine-3-carboxamide (PubChem CID 104982975) has the molecular formula C7H11N5OS and a molecular weight of 213.27 g/mol. Its IUPAC name is (3R)-N-(thiatriazol-5-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(thiatriazol-5-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 104982975 |
| Molecular Formula | C7H11N5OS |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | (3R)-N-(thiatriazol-5-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1nnns1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C7H11N5OS/c13-6(5-2-1-3-8-4-5)9-7-10-11-12-14-7/h5,8H,1-4H2,(H,9,10,12,13)/t5-/m1/s1 |
| InChIKey | XGPZGNNHPLUXAS-RXMQYKEDSA-N |
| XLogP | -0.13 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |