C9H13N3O2 — CID 81139342
(3S)-N-(1,2-oxazol-3-yl)piperidine-3-carboxamide (PubChem CID 81139342) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is (3S)-N-(1,2-oxazol-3-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(1,2-oxazol-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81139342 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (3S)-N-(1,2-oxazol-3-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccon1)[C@H]1CCCNC1 |
| InChI | InChI=1S/C9H13N3O2/c13-9(7-2-1-4-10-6-7)11-8-3-5-14-12-8/h3,5,7,10H,1-2,4,6H2,(H,11,12,13)/t7-/m0/s1 |
| InChIKey | KVWBUQCCOYXTFC-ZETCQYMHSA-N |
| XLogP | 0.61 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |