About 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide
3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide (PubChem CID 164651421) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide |
| PubChem CID | 164651421 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide |
| SMILES | CNC1CC(C(=O)Nc2ccon2)C1 |
| InChI | InChI=1S/C9H13N3O2/c1-10-7-4-6(5-7)9(13)11-8-2-3-14-12-8/h2-3,6-7,10H,4-5H2,1H3,(H,11,12,13) |
| InChIKey | CJNNKVVLCXCKTA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide?
The IUPAC name of 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide (CID 164651421) is 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide.
What is the SMILES notation for 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide?
The canonical SMILES for 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide is CNC1CC(C(=O)Nc2ccon2)C1.
What is the InChIKey of 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide?
The InChIKey is CJNNKVVLCXCKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-10-7-4-6(5-7)9(13)11-8-2-3-14-12-8/h2-3,6-7,10H,4-5H2,1H3,(H,11,12,13).
What are the key properties of 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide?
3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide has a molecular weight of 195.22 g/mol, XLogP of 0.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)-N-(1,2-oxazol-3-yl)cyclobutane-1-carboxamide is sourced from PubChem (CID 164651421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).