C12H16N2O2 — CID 142922852
(2S)-2-cyclopentyl-N-(1,2-oxazol-3-yl)cyclopropane-1-carboxamide (PubChem CID 142922852) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S)-2-cyclopentyl-N-(1,2-oxazol-3-yl)cyclopropane-1-carboxamide.
| Compound Name | (2S)-2-cyclopentyl-N-(1,2-oxazol-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142922852 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2S)-2-cyclopentyl-N-(1,2-oxazol-3-yl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccon1)C1C[C@H]1C1CCCC1 |
| InChI | InChI=1S/C12H16N2O2/c15-12(13-11-5-6-16-14-11)10-7-9(10)8-3-1-2-4-8/h5-6,8-10H,1-4,7H2,(H,13,14,15)/t9-,10?/m0/s1 |
| InChIKey | ONEMZBNEVBCCKW-RGURZIINSA-N |
| XLogP | 2.44 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |