C8H11N3O2 — CID 62902343
N-(1,2-oxazol-3-yl)pyrrolidine-2-carboxamide (PubChem CID 62902343) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N-(1,2-oxazol-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-(1,2-oxazol-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 62902343 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(1,2-oxazol-3-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccon1)C1CCCN1 |
| InChI | InChI=1S/C8H11N3O2/c12-8(6-2-1-4-9-6)10-7-3-5-13-11-7/h3,5-6,9H,1-2,4H2,(H,10,11,12) |
| InChIKey | LQYUHZGJNGNROY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |