C10H15N3O2 — CID 81170885
N-(1,2-oxazol-3-ylmethyl)piperidine-2-carboxamide (PubChem CID 81170885) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)piperidine-2-carboxamide.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 81170885 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)piperidine-2-carboxamide |
| SMILES | O=C(NCc1ccon1)C1CCCCN1 |
| InChI | InChI=1S/C10H15N3O2/c14-10(9-3-1-2-5-11-9)12-7-8-4-6-15-13-8/h4,6,9,11H,1-3,5,7H2,(H,12,14) |
| InChIKey | WKSQLPFQJLKBOD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |