C14H17N3OS — CID 103808102
(2R)-N-(1,3-benzothiazol-2-ylmethyl)piperidine-2-carboxamide (PubChem CID 103808102) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is (2R)-N-(1,3-benzothiazol-2-ylmethyl)piperidine-2-carboxamide.
| Compound Name | (2R)-N-(1,3-benzothiazol-2-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 103808102 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (2R)-N-(1,3-benzothiazol-2-ylmethyl)piperidine-2-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2s1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C14H17N3OS/c18-14(11-6-3-4-8-15-11)16-9-13-17-10-5-1-2-7-12(10)19-13/h1-2,5,7,11,15H,3-4,6,8-9H2,(H,16,18)/t11-/m1/s1 |
| InChIKey | FSZDHMWBKRTXRK-LLVKDONJSA-N |
| XLogP | 2.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |