C12H12N2OS — CID 18110639
N-(1,3-benzothiazol-2-ylmethyl)cyclopropanecarboxamide (PubChem CID 18110639) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)cyclopropanecarboxamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 18110639 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)cyclopropanecarboxamide |
| SMILES | O=C(NCc1nc2ccccc2s1)C1CC1 |
| InChI | InChI=1S/C12H12N2OS/c15-12(8-5-6-8)13-7-11-14-9-3-1-2-4-10(9)16-11/h1-4,8H,5-7H2,(H,13,15) |
| InChIKey | JLDKVOXNYFYMAT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |