C21H22N4O2S — CID 36900031
1-N-(1,3-benzothiazol-2-ylmethyl)-4-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 36900031) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-N-(1,3-benzothiazol-2-ylmethyl)-4-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(1,3-benzothiazol-2-ylmethyl)-4-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 36900031 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-N-(1,3-benzothiazol-2-ylmethyl)-4-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)NCc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H22N4O2S/c26-20(23-16-6-2-1-3-7-16)15-10-12-25(13-11-15)21(27)22-14-19-24-17-8-4-5-9-18(17)28-19/h1-9,15H,10-14H2,(H,22,27)(H,23,26) |
| InChIKey | CYPHLJBYQQCDCV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |