C21H28N4O2S — CID 78886438
N-[3-(1,3-benzothiazol-2-yl)propyl]-4-(cyclopentanecarbonyl)piperazine-1-carboxamide (PubChem CID 78886438) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-4-(cyclopentanecarbonyl)piperazine-1-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-4-(cyclopentanecarbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 78886438 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-4-(cyclopentanecarbonyl)piperazine-1-carboxamide |
| SMILES | O=C(NCCCc1nc2ccccc2s1)N1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C21H28N4O2S/c26-20(16-6-1-2-7-16)24-12-14-25(15-13-24)21(27)22-11-5-10-19-23-17-8-3-4-9-18(17)28-19/h3-4,8-9,16H,1-2,5-7,10-15H2,(H,22,27) |
| InChIKey | GMMDNSMNUBJCGS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|