C16H23N3O2S2 — CID 75402901
N-[3-(1,3-benzothiazol-2-yl)propyl]-2-methylpiperidine-1-sulfonamide (PubChem CID 75402901) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-2-methylpiperidine-1-sulfonamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 75402901 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCCCN1S(=O)(=O)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-13-7-4-5-12-19(13)23(20,21)17-11-6-10-16-18-14-8-2-3-9-15(14)22-16/h2-3,8-9,13,17H,4-7,10-12H2,1H3 |
| InChIKey | GJGYQYBJUJEUQY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|