C21H31N3OS — CID 51951906
4-(1,3-benzothiazol-2-yl)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]butanamide (PubChem CID 51951906) has the molecular formula C21H31N3OS and a molecular weight of 373.57 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 51951906 |
| Molecular Formula | C21H31N3OS |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]butanamide |
| SMILES | C[C@H]1C[C@H](C)CN(CCCNC(=O)CCCc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C21H31N3OS/c1-16-13-17(2)15-24(14-16)12-6-11-22-20(25)9-5-10-21-23-18-7-3-4-8-19(18)26-21/h3-4,7-8,16-17H,5-6,9-15H2,1-2H3,(H,22,25)/t16-,17-/m0/s1 |
| InChIKey | UOMLMFBWHHTDPJ-IRXDYDNUSA-N |
| XLogP | 4.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|