C20H20N4OS2 — CID 55601271
4-(1,3-benzothiazol-2-yl)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]butanamide (PubChem CID 55601271) has the molecular formula C20H20N4OS2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 55601271 |
| Molecular Formula | C20H20N4OS2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]butanamide |
| SMILES | O=C(CCCc1nc2ccccc2s1)NCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H20N4OS2/c25-18(10-5-11-19-23-14-6-1-3-8-16(14)26-19)21-12-13-22-20-24-15-7-2-4-9-17(15)27-20/h1-4,6-9H,5,10-13H2,(H,21,25)(H,22,24) |
| InChIKey | BLZSSTHLYXFNNT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|