C12H16N4OS — CID 120703645
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(methylamino)acetamide (PubChem CID 120703645) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(methylamino)acetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 120703645 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H16N4OS/c1-13-8-11(17)14-6-7-15-12-16-9-4-2-3-5-10(9)18-12/h2-5,13H,6-8H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | PNMVACXHFSCISG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|