C20H30N4O2S — CID 56546359
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N',N'-dipropylpentanediamide (PubChem CID 56546359) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N',N'-dipropylpentanediamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56546359 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H30N4O2S/c1-3-14-24(15-4-2)19(26)11-7-10-18(25)21-12-13-22-20-23-16-8-5-6-9-17(16)27-20/h5-6,8-9H,3-4,7,10-15H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | WMXOKRRBOPZPQW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|