C19H22N4O3S2 — CID 55635604
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-[4-(methylsulfamoyl)phenyl]propanamide (PubChem CID 55635604) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-[4-(methylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-[4-(methylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55635604 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-[4-(methylsulfamoyl)phenyl]propanamide |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)NCCNc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H22N4O3S2/c1-20-28(25,26)15-9-6-14(7-10-15)8-11-18(24)21-12-13-22-19-23-16-4-2-3-5-17(16)27-19/h2-7,9-10,20H,8,11-13H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | IHQXKMFHWSNOLS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|