C17H21N5O2S — CID 55853602
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-4-(3-ethyl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 55853602) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-4-(3-ethyl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-4-(3-ethyl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 55853602 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-4-(3-ethyl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | CCc1noc(CCCC(=O)NCCNc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C17H21N5O2S/c1-2-14-21-16(24-22-14)9-5-8-15(23)18-10-11-19-17-20-12-6-3-4-7-13(12)25-17/h3-4,6-7H,2,5,8-11H2,1H3,(H,18,23)(H,19,20) |
| InChIKey | FXPBXHUZKYUEES-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|