C16H16N4O2S — CID 47027911
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(2-oxo-1-pyridinyl)acetamide (PubChem CID 47027911) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 47027911 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(2-oxo-1-pyridinyl)acetamide |
| SMILES | O=C(Cn1ccccc1=O)NCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H16N4O2S/c21-14(11-20-10-4-3-7-15(20)22)17-8-9-18-16-19-12-5-1-2-6-13(12)23-16/h1-7,10H,8-9,11H2,(H,17,21)(H,18,19) |
| InChIKey | FIWRDGSDSDMXLT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|