C15H21N3OS — CID 47165966
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3,3-dimethylbutanamide (PubChem CID 47165966) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 47165966 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H21N3OS/c1-15(2,3)10-13(19)16-8-9-17-14-18-11-6-4-5-7-12(11)20-14/h4-7H,8-10H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | VKZAYRLRDAJGTD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|