C14H19N3O2S — CID 87530986
2-(1,3-benzothiazol-2-ylamino)ethyl-tert-butylcarbamic acid (PubChem CID 87530986) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)ethyl-tert-butylcarbamic acid.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)ethyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87530986 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)ethyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCNc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C14H19N3O2S/c1-14(2,3)17(13(18)19)9-8-15-12-16-10-6-4-5-7-11(10)20-12/h4-7H,8-9H2,1-3H3,(H,15,16)(H,18,19) |
| InChIKey | YAXDZYHOHMIQKK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |